diethyl 2-amino-5-methylfuran-3,4-dicarboxylate structure
|
Common Name | diethyl 2-amino-5-methylfuran-3,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 91248-60-1 | Molecular Weight | 241.24000 | |
| Density | 1.208g/cm3 | Boiling Point | 326.2ºC at 760mmHg | |
| Molecular Formula | C11H15NO5 | Melting Point | 81-94ºC | |
| MSDS | N/A | Flash Point | 151.1ºC | |
| Name | diethyl 2-amino-5-methylfuran-3,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 326.2ºC at 760mmHg |
| Melting Point | 81-94ºC |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24000 |
| Flash Point | 151.1ºC |
| Exact Mass | 241.09500 |
| PSA | 91.76000 |
| LogP | 2.10480 |
| Index of Refraction | 1.517 |
| InChIKey | KJHBLQGLKJXASY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)oc(N)c1C(=O)OCC |
| HS Code | 2932190090 |
|---|
|
~92%
diethyl 2-amino... CAS#:91248-60-1 |
| Literature: Bakavoli, Mehdi; Feizyzadeh, Babak; Rahimizadeh, Mohammad Tetrahedron Letters, 2006 , vol. 47, # 50 p. 8965 - 8968 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| ethyl 5-amino-4-(ethoxycarbonyl)-2-methylfuran-3-carboxylate |
| Diethyl 2-amino-5-methyl-3,4-furandicarboxylate |
| HMS1761I15 |
| 2-Amino-3,4-diethoxycarbonyl-5-methyl-furan |
| 2-amino-5-methyl-furan-3,4-dicarboxylic acid diethyl ester |