methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate structure
|
Common Name | methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 914347-01-6 | Molecular Weight | 300.15200 | |
| Density | 1.486g/cm3 | Boiling Point | 410.531ºC at 760 mmHg | |
| Molecular Formula | C11H14BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.082ºC | |
| Name | methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 410.531ºC at 760 mmHg |
| Molecular Formula | C11H14BrN3O2 |
| Molecular Weight | 300.15200 |
| Flash Point | 202.082ºC |
| Exact Mass | 299.02700 |
| PSA | 55.32000 |
| LogP | 1.69350 |
| Index of Refraction | 1.566 |
| InChIKey | CCUNQFMNCAFIEV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(c2ncc(Br)cn2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD08275691 |