4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid structure
|
Common Name | 4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid | ||
|---|---|---|---|---|
| CAS Number | 914637-49-3 | Molecular Weight | 342.10700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5F11O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5F11O2 |
|---|---|
| Molecular Weight | 342.10700 |
| Exact Mass | 342.01100 |
| PSA | 37.30000 |
| LogP | 3.95470 |
| InChIKey | ABFCFCPCGMHSRX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | C |
|---|---|
| HS Code | 2915900090 |
|
~%
4,4,5,5,6,6,7,7... CAS#:914637-49-3 |
| Literature: Zarif, Leila; Greiner, Jacques; Pace, Simonne; Riess, Jean G. Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1262 - 1269 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 1h-indazol-3-ylacetaldehyde |
| indazole-3-acetaldehyde |