Biphenyl-2-boronic acid pinacol ester structure
|
Common Name | Biphenyl-2-boronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 914675-52-8 | Molecular Weight | 280.169 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 408.1±24.0 °C at 760 mmHg | |
| Molecular Formula | C18H21BO2 | Melting Point | 76-79℃ | |
| MSDS | N/A | Flash Point | 200.6±22.9 °C | |
| Name | Biphenyl-2-boronic acid pinacol ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.1±24.0 °C at 760 mmHg |
| Melting Point | 76-79℃ |
| Molecular Formula | C18H21BO2 |
| Molecular Weight | 280.169 |
| Flash Point | 200.6±22.9 °C |
| Exact Mass | 280.163452 |
| PSA | 18.46000 |
| LogP | 3.65280 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | WCXWQEUBHZKNMQ-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2ccccc2-c2ccccc2)OC1(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-(2-Biphenylyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| 1,3,2-Dioxaborolane, 2-[1,1'-biphenyl]-2-yl-4,4,5,5-tetramethyl- |