2-[(4-nitrophenyl)disulfanyl]pyridine structure
|
Common Name | 2-[(4-nitrophenyl)disulfanyl]pyridine | ||
|---|---|---|---|---|
| CAS Number | 91933-69-6 | Molecular Weight | 264.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(4-nitrophenyl)disulfanyl]pyridine |
|---|
| Molecular Formula | C11H8N2O2S2 |
|---|---|
| Molecular Weight | 264.32300 |
| Exact Mass | 264.00300 |
| PSA | 109.31000 |
| LogP | 4.31240 |
| InChIKey | APSZXPLSHXTBAB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(SSc2ccccn2)cc1 |
|
~32%
2-[(4-nitrophen... CAS#:91933-69-6 |
| Literature: Sato, Ryu; Chiba, Shuji; Saito, Nobushige; Sato, Mikiya; Saito, Minoru Phosphorus and Sulfur and the Related Elements, 1984 , vol. 19, p. 205 - 212 |
|
~%
2-[(4-nitrophen... CAS#:91933-69-6 |
| Literature: Leandri; Tundo Annali di Chimica (Rome, Italy), 1955 , vol. 45, p. 842,847, 848 |