Propanedioic acid,2-hexylidene-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-hexylidene-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 91976-53-3 | Molecular Weight | 242.31100 | |
| Density | 0.995g/cm3 | Boiling Point | 276.8ºC at 760 mmHg | |
| Molecular Formula | C13H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.1ºC | |
| Name | diethyl 2-hexylidenepropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.995g/cm3 |
|---|---|
| Boiling Point | 276.8ºC at 760 mmHg |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31100 |
| Flash Point | 123.1ºC |
| Exact Mass | 242.15200 |
| PSA | 52.60000 |
| LogP | 2.61930 |
| Index of Refraction | 1.452 |
| InChIKey | XLMIJZNPBJRMBG-UHFFFAOYSA-N |
| SMILES | CCCCCC=C(C(=O)OCC)C(=O)OCC |
|
~77%
Propanedioic ac... CAS#:91976-53-3 |
| Literature: Ranu, Brindaban C.; Jana, Ranjan European Journal of Organic Chemistry, 2006 , # 16 p. 3767 - 3770 |
| Hexyliden-malonsaeure-diaethylester |
| Monohexyliden-malonsaeure-diethylester |
| hexylidene-malonic acid diethyl ester |
| diethyl hexylidenemalonate |
| 2-hexylidene-malonic acid diethyl ester |