2,7-Naphthalenedisulfonicacid, 3-amino structure
|
Common Name | 2,7-Naphthalenedisulfonicacid, 3-amino | ||
|---|---|---|---|---|
| CAS Number | 92-28-4 | Molecular Weight | 303.31200 | |
| Density | 1.769g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Aminonaphthalene-3,6-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.769g/cm3 |
|---|---|
| Molecular Formula | C10H9NO6S2 |
| Molecular Weight | 303.31200 |
| Exact Mass | 302.98700 |
| PSA | 151.52000 |
| LogP | 3.65820 |
| Index of Refraction | 1.733 |
| InChIKey | UCTREIIEJSFTDI-UHFFFAOYSA-N |
| SMILES | Nc1cc2ccc(S(=O)(=O)O)cc2cc1S(=O)(=O)O |
| RIDADR | UN 1759 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2921499090 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-aminonaphthalene-2,7-disulphonic acid |
| 2,7-Naphthalenedisulfonic acid,3-amino |
| 2-naphthylamine-3,6-disulphonic acid |
| 3-amino-2,7-disulfonic acid |
| 2-naphthylamine-3,6-disulfonic acid |
| 3-azanylnaphthalene-2,7-disulfonic acid |
| 2-amino-3,6-naphthalenedisulphonic acid |
| 3-amino-naphthalene-2,7-disulfonic acid |
| Amido R acid |
| amino-R acid |