naphthalene-2,7-disulfonic acid structure
|
Common Name | naphthalene-2,7-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 92-41-1 | Molecular Weight | 288.29700 | |
| Density | 1.704 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8O6S2 | Melting Point | 80-84 °C(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalene-2,7-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.704 g/cm3 |
|---|---|
| Melting Point | 80-84 °C(lit.) |
| Molecular Formula | C10H8O6S2 |
| Molecular Weight | 288.29700 |
| Exact Mass | 287.97600 |
| PSA | 125.50000 |
| LogP | 3.49480 |
| Index of Refraction | 1.695 |
| InChIKey | VILFVXYKHXVYAB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2ccc(S(=O)(=O)O)cc2c1 |
| RIDADR | 1759 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904100000 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 202-154-6 |
| MFCD00035734 |
| Naphthalene-2,7-disulphonic acid |
| 2,7-Naphthalene disulfonic acid |
| Naphthalin-disulfonsaeure-(2.7) |
| ebert-merz a-acid |
| naphthalene-2,7-disulfonate |
| 2,7-naphthalenedisulphonic acid |
| Naphthalin-2,7-disulfonsaeure |
| Naphthalene-2,7-disulfonic acid |