naphthalene-2,7-disulfonic acid
naphthalene-2,7-disulfonic acid structure
|
Common Name | naphthalene-2,7-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 92-41-1 | Molecular Weight | 288.29700 | |
| Density | 1.704 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8O6S2 | Melting Point | 80-84 °C(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | naphthalene-2,7-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.704 g/cm3 |
|---|---|
| Melting Point | 80-84 °C(lit.) |
| Molecular Formula | C10H8O6S2 |
| Molecular Weight | 288.29700 |
| Exact Mass | 287.97600 |
| PSA | 125.50000 |
| LogP | 3.49480 |
| Index of Refraction | 1.695 |
| InChIKey | VILFVXYKHXVYAB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2ccc(S(=O)(=O)O)cc2c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| RIDADR | 1759 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904100000 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 10 | |
CAS#:91-20-3
CAS#:120-18-3
CAS#:81-04-9
CAS#:6251-07-6
CAS#:486-54-4
CAS#:7664-93-9
CAS#:581-75-9
CAS#:85-47-2
CAS#:525-37-1
CAS#:92-28-4
CAS#:58556-75-5
CAS#:578-85-8
CAS#:90-20-0
CAS#:2198-77-8
CAS#:86-66-8
CAS#:71977-56-5
CAS#:582-17-2
CAS#:19551-16-7
CAS#:92-40-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 202-154-6 |
| MFCD00035734 |
| Naphthalene-2,7-disulphonic acid |
| 2,7-Naphthalene disulfonic acid |
| Naphthalin-disulfonsaeure-(2.7) |
| ebert-merz a-acid |
| naphthalene-2,7-disulfonate |
| 2,7-naphthalenedisulphonic acid |
| Naphthalin-2,7-disulfonsaeure |
| Naphthalene-2,7-disulfonic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of naphthalene-2,7-disulfonic acid? |
| A: CAS number of naphthalene-2,7-disulfonic acid is 92-41-1. |
| Q: What is the polar surface area (PSA) of naphthalene-2,7-disulfonic acid? |
| A: Polar surface area (PSA) of naphthalene-2,7-disulfonic acid is 125.50000. |
| Q: What is the melting point of naphthalene-2,7-disulfonic acid? |
| A: Melting point of naphthalene-2,7-disulfonic acid is 80-84 °C(lit.). |
| Q: What is the InChIKey of naphthalene-2,7-disulfonic acid? |
| A: InChIKey of naphthalene-2,7-disulfonic acid is VILFVXYKHXVYAB-UHFFFAOYSA-N. |
| Q: What is the LogP of naphthalene-2,7-disulfonic acid? |
| A: LogP of naphthalene-2,7-disulfonic acid is 3.49480. |
| Q: What is the English name of naphthalene-2,7-disulfonic acid? |
| A: The English name of naphthalene-2,7-disulfonic acid is naphthalene-2,7-disulfonic acid. |
| Q: What are the upstream materials of naphthalene-2,7-disulfonic acid? |
| A: Related upstream materials(CAS) of naphthalene-2,7-disulfonic acid: 91-20-3;120-18-3;81-04-9;6251-07-6;486-54-4;7664-93-9;581-75-9;85-47-2;525-37-1;92-28-4. |
| Q: What is the molecular weight of naphthalene-2,7-disulfonic acid? |
| A: Molecular weight of naphthalene-2,7-disulfonic acid is 288.29700. |
| Q: What is the SMILES notation of naphthalene-2,7-disulfonic acid? |
| A: SMILES notation of naphthalene-2,7-disulfonic acid is O=S(=O)(O)c1ccc2ccc(S(=O)(=O)O)cc2c1. |
| Q: What is the molecular formula of naphthalene-2,7-disulfonic acid? |
| A: Molecular formula of naphthalene-2,7-disulfonic acid is C10H8O6S2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |