3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one
3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one structure
|
Common Name | 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one | ||
|---|---|---|---|---|
| CAS Number | 93098-01-2 | Molecular Weight | 266.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-(4-Methoxyphenyl)-2-phenyl-2H-furan-5-one (CAS number: 93098-01-2, molecular formula: C17H14O3, molecular weight: 266.29100), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14O3 |
|---|---|
| Molecular Weight | 266.29100 |
| Exact Mass | 266.09400 |
| PSA | 35.53000 |
| LogP | 3.37670 |
| InChIKey | TYSQCCSULGBSJZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=CC(=O)OC2c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-(4-methoxyphe... CAS#:93098-01-2 |
| Literature: Oh, Chang Ho; Park, Su Jin; Ryu, Jin Hyang; Gupta, Arun Kumar Tetrahedron Letters, 2004 , vol. 45, # 38 p. 7039 - 7042 |
|
~86%
3-(4-methoxyphe... CAS#:93098-01-2 |
| Literature: Dikshit; Singh; Kamboj Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1990 , vol. 29, # 10 p. 954 - 960 |
|
~8%
3-(4-methoxyphe... CAS#:93098-01-2
Detail
Learn More
|
| Literature: Ranade, A. C.; Mali, R. S.; Kurnawal, V. M. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1984 , vol. 23, # 6 p. 514 - 517 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one? |
| A: SMILES notation of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one is COc1ccc(C2=CC(=O)OC2c2ccccc2)cc1. |
| Q: What is the CAS number of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one? |
| A: CAS number of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one is 93098-01-2. |
| Q: What is the Chinese name of 93098-01-2? |
| A: Chinese name of 93098-01-2 is 93098-01-2. |
| Q: What is the LogP of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one? |
| A: LogP of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one is 3.37670. |
| Q: What is the English name of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one? |
| A: The English name of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one is 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one. |
| Q: What is the molecular weight of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one? |
| A: Molecular weight of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one is 266.29100. |
| Q: What is the InChIKey of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one? |
| A: InChIKey of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one is TYSQCCSULGBSJZ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one? |
| A: Polar surface area (PSA) of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one is 35.53000. |
| Q: What is the molecular formula of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one? |
| A: Molecular formula of 3-(4-methoxyphenyl)-2-phenyl-2H-furan-5-one is C17H14O3. |