2-hydroxy-1-(4-methoxyphenyl)-2-phenyl-ethanone structure
|
Common Name | 2-hydroxy-1-(4-methoxyphenyl)-2-phenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 4254-17-5 | Molecular Weight | 242.27000 | |
| Density | 1.188g/cm3 | Boiling Point | 421ºC at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.5ºC | |
| Name | 2-hydroxy-1-(4-methoxyphenyl)-2-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 421ºC at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 159.5ºC |
| Exact Mass | 242.09400 |
| PSA | 46.53000 |
| LogP | 2.61150 |
| Index of Refraction | 1.591 |
| InChIKey | PVSFIFPJPUEHPO-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(O)c2ccccc2)cc1 |
| HS Code | 2914509090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (+-)-4-Methoxy-benzoin |
| p-methoxybenzoin |
| 2-hydroxy-1-(4-methoxy-phenyl)-2-phenyl-ethanone |