2,6-bis(2,2,2-trifluoroethoxy)benzonitrile structure
|
Common Name | 2,6-bis(2,2,2-trifluoroethoxy)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 93624-57-8 | Molecular Weight | 299.16900 | |
| Density | 1.42 g/cm3 | Boiling Point | 305.9ºC at 760 mmHg | |
| Molecular Formula | C11H7F6NO2 | Melting Point | 115 °C | |
| MSDS | N/A | Flash Point | 138.8ºC | |
| Name | 2,6-bis(2,2,2-trifluoroethoxy)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42 g/cm3 |
|---|---|
| Boiling Point | 305.9ºC at 760 mmHg |
| Melting Point | 115 °C |
| Molecular Formula | C11H7F6NO2 |
| Molecular Weight | 299.16900 |
| Flash Point | 138.8ºC |
| Exact Mass | 299.03800 |
| PSA | 42.25000 |
| LogP | 3.44048 |
| Index of Refraction | 1.43 |
| InChIKey | YVHZUTZJZUYWBO-UHFFFAOYSA-N |
| SMILES | N#Cc1c(OCC(F)(F)F)cccc1OCC(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S36/37 |
| RIDADR | 3439 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2926909090 |
|
~75%
2,6-bis(2,2,2-t... CAS#:93624-57-8 |
| Literature: Gupton, John T.; Hertel, George; DeCrescenzo, Gary; Colon, Cesar; Baran, Donna; et al. Canadian Journal of Chemistry, 1985 , vol. 63, p. 3037 - 3042 |
|
~53%
2,6-bis(2,2,2-t... CAS#:93624-57-8 |
| Literature: Gupton, John T.; Idoux, John P.; DeCrescenzo, Gary; Colon, Cesar Synthetic Communications, 1984 , vol. 14, # 7 p. 621 - 630 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| hms557a03 |
| MFCD00109080 |