H-Val-His-Leu-Thr-Pro-OH structure
|
Common Name | H-Val-His-Leu-Thr-Pro-OH | ||
|---|---|---|---|---|
| CAS Number | 93913-38-3 | Molecular Weight | 565.66200 | |
| Density | 1.282g/cm3 | Boiling Point | 1003.153ºC at 760 mmHg | |
| Molecular Formula | C26H43N7O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 560.487ºC | |
Use of H-Val-His-Leu-Thr-Pro-OHVHLTP is the N-terminal pentapeptide of human hemoglobin beta. VHLTP binds to cell membranes and serves as a ligand for anti-HbA1c antibodies[1]. |
| Name | 1-[2-[[2-[[2-[(2-amino-3-methylbutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | VHLTP is the N-terminal pentapeptide of human hemoglobin beta. VHLTP binds to cell membranes and serves as a ligand for anti-HbA1c antibodies[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 1003.153ºC at 760 mmHg |
| Molecular Formula | C26H43N7O7 |
| Molecular Weight | 565.66200 |
| Flash Point | 560.487ºC |
| Exact Mass | 565.32200 |
| PSA | 230.31000 |
| LogP | 2.05150 |
| Index of Refraction | 1.567 |
| InChIKey | BYCSDJAWFOZAFO-WUEZWNDSSA-N |
| SMILES | CC(C)CC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)C(C)C)C(=O)NC(C(=O)N1CCCC1C(=O)O)C(C)O |
| 1-(2-{2-[2-(2-amino-3-methylbutanamido)-3-(1H-imidazol-4-yl)propanamido]-4-methylpentanamido}-3-hydroxybutanoyl)pyrrolidine-2-carboxylic acid |
| VAL-HIS-LEU-THR-PRO |
| H-Val-His-Leu-Thr-Pro-OH |