Poliumoside structure
|
Common Name | Poliumoside | ||
|---|---|---|---|---|
| CAS Number | 94079-81-9 | Molecular Weight | 770.728 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 1023.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C35H46O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.2±27.8 °C | |
Use of PoliumosidePoliumoside is a natural compound which exhibit significant inhibition of advanced glycation end product formation with IC50 value of 4.6-25.7 μM.IC50 value: Target: Poliumoside exhibited greater inhibitory effects on rat lens aldose reductase with IC50 values of 0.85 μM, than those of the positive controls, 3,3-tetramethyleneglutaric acid (IC50=4.03 μM) and quercetin (IC50=7.2 μM). |
| Name | [6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | Poliumoside is a natural compound which exhibit significant inhibition of advanced glycation end product formation with IC50 value of 4.6-25.7 μM.IC50 value: Target: Poliumoside exhibited greater inhibitory effects on rat lens aldose reductase with IC50 values of 0.85 μM, than those of the positive controls, 3,3-tetramethyleneglutaric acid (IC50=4.03 μM) and quercetin (IC50=7.2 μM). |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 1023.2±65.0 °C at 760 mmHg |
| Molecular Formula | C35H46O19 |
| Molecular Weight | 770.728 |
| Flash Point | 316.2±27.8 °C |
| Exact Mass | 770.263306 |
| PSA | 304.21000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | YMWRMAOPKNYHMZ-YOQCIRBJSA-N |
| SMILES | CC1OC(OCC2OC(OCCc3ccc(O)c(O)c3)C(O)C(OC3OC(C)C(O)C(O)C3O)C2OC(=O)C=Cc2ccc(O)c(O)c2)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|
| β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-6-deoxy-α-L-mannopyranosyl-(1->3)-O-[6-deoxy-α-L-mannopyranosyl-(1->6)]-4-O-[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]- |
| 2-(1H-TETRAZOL-1-YL)ISONICOTINIC ACID |
| poliumoside |
| Y0162 |
| 2-(3,4-Dihydroxyphenyl)ethyl 6-deoxy-α-L-mannopyranosyl-(1->3)-[6-deoxy-α-L-mannopyranosyl-(1->6)]-4-O-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]-β-D-glucopyranoside |