TBBPA carbonate oligomer BC52 structure
|
Common Name | TBBPA carbonate oligomer BC52 | ||
|---|---|---|---|---|
| CAS Number | 94334-64-2 | Molecular Weight | 736.89800 | |
| Density | N/A | Boiling Point | 417.9ºC at 760mmHg | |
| Molecular Formula | C22H18Br4Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | carbonyl dichloride,2,6-dibromo-4-[2-(3,5-dibromo-4-hydroxyphenyl)propan-2-yl]phenol,phenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 417.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H18Br4Cl2O4 |
| Molecular Weight | 736.89800 |
| Exact Mass | 731.73200 |
| PSA | 77.76000 |
| LogP | 9.44990 |
| InChIKey | LJNDPOUIYDAJNC-UHFFFAOYSA-N |
| SMILES | CC(C)(c1cc(Br)c(O)c(Br)c1)c1cc(Br)c(O)c(Br)c1.O=C(Cl)Cl.Oc1ccccc1 |
| RIDADR | UN 3152 |
|---|---|
| Packaging Group | II |
| Hazard Class | 9 |
| TBBPA carbonate oligomer BC52 |
| Carbonic dichloride,polymer with 4,4'-(1-methylethylidene)bis(2,6-dibromophenol) and phenol |
| 2,6-dibromo-4-[1-(3,5-dibromo-4-hydroxy-phenyl)-1-methyl-ethyl]phenol |
| Polymer of tetrabromobisphenol A,phosgene,phenol |