1-(7-Bromo-1H-indol-3-yl)ethanone structure
|
Common Name | 1-(7-Bromo-1H-indol-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 944086-09-3 | Molecular Weight | 238.081 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 389.0±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H8BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.1±22.3 °C | |
| Name | 1-(7-Bromo-1H-indol-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.0±22.0 °C at 760 mmHg |
| Molecular Formula | C10H8BrNO |
| Molecular Weight | 238.081 |
| Flash Point | 189.1±22.3 °C |
| Exact Mass | 236.978912 |
| PSA | 32.86000 |
| LogP | 2.83 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | ZRGRITPJQJCAFA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c[nH]c2c(Br)cccc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~91%
1-(7-Bromo-1H-i... CAS#:944086-09-3 |
| Literature: ACADIA PHARMACEUTICALS INC. Patent: WO2007/79239 A2, 2007 ; Location in patent: Page/Page column 75-76 ; WO 2007/079239 A2 |
|
~%
1-(7-Bromo-1H-i... CAS#:944086-09-3 |
| Literature: Simon, Gaelle; Couthon-Gourves, Helene; Haelters, Jean-Pierre; Corbel, Bernard; Kervarec, Nelly; Michaud, Francois; Meijer, Laurent Journal of Heterocyclic Chemistry, 2007 , vol. 44, # 4 p. 793 - 801 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-acetyl-7-bromo-1H-indole |
| 1-(7-Bromo-1H-indol-3-yl)ethanone |
| Ethanone, 1-(7-bromo-1H-indol-3-yl)- |