Trimethyl(2-naphthyl)stannane structure
|
Common Name | Trimethyl(2-naphthyl)stannane | ||
|---|---|---|---|---|
| CAS Number | 945-77-7 | Molecular Weight | 290.96700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(naphthalen-2-yl)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16Sn |
|---|---|
| Molecular Weight | 290.96700 |
| Exact Mass | 292.02700 |
| LogP | 3.42900 |
| InChIKey | GEQLRPOZNCKPIG-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)c1ccc2ccccc2c1 |
| HS Code | 2931900090 |
|---|
|
~0%
Detail
|
| Literature: Rhone-Poulenc Rorer Pharmaceuticals Inc. Patent: US5556990 A1, 1996 ; |
|
~10%
Trimethyl(2-nap... CAS#:945-77-7 |
| Literature: Chopa, Alicia B.; Lockhart, Maria T.; Dorn, Viviana B. Organometallics, 2002 , vol. 21, # 7 p. 1425 - 1429 |
|
~28%
Trimethyl(2-nap... CAS#:945-77-7 |
| Literature: Gmelin Handbook: Sn: Org.Verb.2, 1.1.2.1.12, page 146 - 152 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Trimethyl(2-naphthyl)stannane |
| (2-naphthyl)trimethylstannane |
| Naphth-2-yltrimethylstannane |
| Stannane,trimethyl-2-naphthyl |
| Stannane,trimethyl-2-naphthalenyl |
| 2-trimethylstannylnaphthalene |