BOC-SER(TOS)-OBZL structure
|
Common Name | BOC-SER(TOS)-OBZL | ||
|---|---|---|---|---|
| CAS Number | 94882-74-3 | Molecular Weight | 449.51700 | |
| Density | 1.239g/cm3 | Boiling Point | 603.703ºC at 760 mmHg | |
| Molecular Formula | C22H27NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.908ºC | |
| Name | benzyl (2S)-3-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 603.703ºC at 760 mmHg |
| Molecular Formula | C22H27NO7S |
| Molecular Weight | 449.51700 |
| Flash Point | 318.908ºC |
| Exact Mass | 449.15100 |
| PSA | 116.38000 |
| LogP | 4.80870 |
| Index of Refraction | 1.551 |
| InChIKey | ITSLINPVUWRCFB-IBGZPJMESA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC(NC(=O)OC(C)(C)C)C(=O)OCc2ccccc2)cc1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-O-tosyl-L-serine benzyl ester |