2-((6-Chloropyridazin-3-yl)methyl)isoindoline-1,3-dione structure
|
Common Name | 2-((6-Chloropyridazin-3-yl)methyl)isoindoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 948996-03-0 | Molecular Weight | 273.674 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 503.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H8ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.5±27.3 °C | |
| Name | 2-((6-Chloropyridazin-3-yl)methyl)isoindoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 503.8±40.0 °C at 760 mmHg |
| Molecular Formula | C13H8ClN3O2 |
| Molecular Weight | 273.674 |
| Flash Point | 258.5±27.3 °C |
| Exact Mass | 273.030518 |
| PSA | 63.16000 |
| LogP | 1.21 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | USJYLXOIXHYZKF-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(Cl)nn1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Isoindole-1,3(2H)-dione, 2-[(6-chloro-3-pyridazinyl)methyl]- |
| 2-[(6-chloropyridazin-3-yl)methyl]isoindole-1,3-dione |
| 2-[(6-Chloro-3-pyridazinyl)methyl]-1H-isoindole-1,3(2H)-dione |