AKOS BB-7588 structure
|
Common Name | AKOS BB-7588 | ||
|---|---|---|---|---|
| CAS Number | 95104-22-6 | Molecular Weight | 216.66600 | |
| Density | 1.273g/cm3 | Boiling Point | 391.966ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.854ºC | |
| Name | 2-Chloro-6,7-dimethylquinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 391.966ºC at 760 mmHg |
| Molecular Formula | C12H9ClN2 |
| Molecular Weight | 216.66600 |
| Flash Point | 190.854ºC |
| Exact Mass | 216.04500 |
| PSA | 36.68000 |
| LogP | 3.37668 |
| Index of Refraction | 1.632 |
| InChIKey | RWTVCAFOPUIWIV-UHFFFAOYSA-N |
| SMILES | Cc1cc2cc(C#N)c(Cl)nc2cc1C |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chloro-6,7-dimethyl-quinoline-3-carbonitrile |