AKOS BB-7586
Modify Date: 2025-08-25 07:50:51
AKOS BB-7586 structure
|
Common Name | AKOS BB-7586 | ||
|---|---|---|---|---|
| CAS Number | 351363-12-7 | Molecular Weight | 216.66600 | |
| Density | 1.27g/cm3 | Boiling Point | 385.3ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 186.8ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 2-Chloro-5,8-dimethylquinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 385.3ºC at 760 mmHg |
| Molecular Formula | C12H9ClN2 |
| Molecular Weight | 216.66600 |
| Flash Point | 186.8ºC |
| Exact Mass | 216.04500 |
| PSA | 36.68000 |
| LogP | 3.37668 |
| Index of Refraction | 1.632 |
| InChIKey | SXMZARFPNUVUNV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c2nc(Cl)c(C#N)cc12 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319 |
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS2664O12 |
| 2-Chloro-5,8-dimethyl-quinoline-3-carbonitrile |