AKOS BB-9596 structure
|
Common Name | AKOS BB-9596 | ||
|---|---|---|---|---|
| CAS Number | 63382-10-5 | Molecular Weight | 208.25400 | |
| Density | 1.2g/cm3 | Boiling Point | 300.9ºC at 760 mmHg | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 130.5ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 4-Oxo-1-adamantyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 300.9ºC at 760 mmHg |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25400 |
| Flash Point | 130.5ºC |
| Exact Mass | 208.11000 |
| PSA | 43.37000 |
| LogP | 1.69730 |
| Index of Refraction | 1.528 |
| InChIKey | HXHDLUJUHIBGGK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC12CC3CC(C1)C(=O)C(C3)C2 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2915390090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 4-oxo-1-adamantyl acetate(SALTDATA: FREE) |