Artemetin acetate structure
|
Common Name | Artemetin acetate | ||
|---|---|---|---|---|
| CAS Number | 95135-98-1 | Molecular Weight | 430.405 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 589.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H22O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.9±30.2 °C | |
| Name | 2-(3,4-Dimethoxyphenyl)-3,6,7-trimethoxy-4-oxo-4H-chromen-5-yl ac etate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 589.8±50.0 °C at 760 mmHg |
| Molecular Formula | C22H22O9 |
| Molecular Weight | 430.405 |
| Flash Point | 255.9±30.2 °C |
| Exact Mass | 430.126373 |
| PSA | 102.66000 |
| LogP | 1.84 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | OROIGYYSOAHXJV-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3cc(OC)c(OC)c(OC(C)=O)c3c(=O)c2OC)cc1OC |
| Hazard Codes | Xi |
|---|
|
~%
Artemetin acetate CAS#:95135-98-1 |
| Literature: Chawla, A. S.; Sharma, A. K.; Handa, S. S.; Dhar, K. L. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1991 , vol. 30, # 8 p. 773 - 776 |
|
~%
Artemetin acetate CAS#:95135-98-1 |
| Literature: Perkin Journal of the Chemical Society, 1913 , vol. 103, p. 210 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Acetoxy-3,6,7,3',4'-pentamethoxy-flavon |
| 5-Acetoxy-1H-pyrimidin-2,4-dion |
| 4H-1-Benzopyran-4-one, 5-(acetyloxy)-2-(3,4-dimethoxyphenyl)-3,6,7-trimethoxy- |
| 2-(3,4-Dimethoxyphenyl)-3,6,7-trimethoxy-4-oxo-4H-chromen-5-yl acetate |
| 5-acetoxy-1H-pyrimidine-2,4-dione |