4-Chloro-2,6-dinitrobenzoic acid structure
|
Common Name | 4-Chloro-2,6-dinitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 95192-57-7 | Molecular Weight | 246.56200 | |
| Density | 1.791g/cm3 | Boiling Point | 395.3ºC at 760mmHg | |
| Molecular Formula | C7H3ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.9ºC | |
| Name | 4-Chloro-2,6-dinitrobenzoic acid |
|---|
| Density | 1.791g/cm3 |
|---|---|
| Boiling Point | 395.3ºC at 760mmHg |
| Molecular Formula | C7H3ClN2O6 |
| Molecular Weight | 246.56200 |
| Flash Point | 192.9ºC |
| Exact Mass | 245.96800 |
| PSA | 128.94000 |
| LogP | 2.90100 |
| Index of Refraction | 1.666 |
| InChIKey | GQWMLRJMEVDSOK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c([N+](=O)[O-])cc(Cl)cc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~%
4-Chloro-2,6-di... CAS#:95192-57-7 |
| Literature: Journal of Organic Chemistry, , vol. 50, # 7 p. 1041 - 1045 |
|
~%
4-Chloro-2,6-di... CAS#:95192-57-7 |
| Literature: Journal of Organic Chemistry, , vol. 50, # 7 p. 1041 - 1045 |
|
~%
4-Chloro-2,6-di... CAS#:95192-57-7 |
| Literature: Journal of Organic Chemistry, , vol. 50, # 7 p. 1041 - 1045 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |