2,6-DINITROBENZOIC ACID structure
|
Common Name | 2,6-DINITROBENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 603-12-3 | Molecular Weight | 212.11600 | |
| Density | 1.688g/cm3 | Boiling Point | 395.5ºC at 760 mmHg | |
| Molecular Formula | C7H4N2O6 | Melting Point | 202-206ºC | |
| MSDS | N/A | Flash Point | 179.2ºC | |
| Name | 2,6-Dinitrobenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.688g/cm3 |
|---|---|
| Boiling Point | 395.5ºC at 760 mmHg |
| Melting Point | 202-206ºC |
| Molecular Formula | C7H4N2O6 |
| Molecular Weight | 212.11600 |
| Flash Point | 179.2ºC |
| Exact Mass | 212.00700 |
| PSA | 128.94000 |
| LogP | 2.24760 |
| Index of Refraction | 1.658 |
| InChIKey | HKKWSIQQYJTJLW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,6-Dinitrobenzoic acid |