4-Chloro-2,6-pyridinedicarboxylic acid structure
|
Common Name | 4-Chloro-2,6-pyridinedicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 4722-94-5 | Molecular Weight | 201.56400 | |
| Density | 1.684g/cm3 | Boiling Point | 457.1ºC at 760mmHg | |
| Molecular Formula | C7H4ClNO4 | Melting Point | 210ºC | |
| MSDS | N/A | Flash Point | 230.2ºC | |
| Name | 4-Chloropyridine-2,6-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.684g/cm3 |
|---|---|
| Boiling Point | 457.1ºC at 760mmHg |
| Melting Point | 210ºC |
| Molecular Formula | C7H4ClNO4 |
| Molecular Weight | 201.56400 |
| Flash Point | 230.2ºC |
| Exact Mass | 200.98300 |
| PSA | 87.49000 |
| LogP | 1.13140 |
| Index of Refraction | 1.639 |
| InChIKey | IYUMNONNHYADBU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)cc(C(=O)O)n1 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-2,6-pyridinedicarboxylic acid |
| 4-CHLORO-PYRIDINE-2,6-DICARBOXYLIC ACID |
| chloropyridinedicarboxylicacid |
| 4-chloro-2,6-pyridinecarboxylic acid |
| 4-Chlor-2,6-pyridindicarbonsaeure |
| 4-chlorodipicolinic acid |
| 4-Chloro-2,6-pyridinedicarboxylic Acid |
| 4-Chloro-pyridine-2,6-dicarboxylic |