4-((4-Isopropoxyphenyl)sulfonyl)phenol structure
|
Common Name | 4-((4-Isopropoxyphenyl)sulfonyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 95235-30-6 | Molecular Weight | 292.350 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 478.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O4S | Melting Point | 129 °C | |
| MSDS | N/A | Flash Point | 243.4±24.6 °C | |
| Name | 4-((4-Isopropoxyphenyl)sulfonyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.8±30.0 °C at 760 mmHg |
| Melting Point | 129 °C |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.350 |
| Flash Point | 243.4±24.6 °C |
| Exact Mass | 292.076935 |
| PSA | 71.98000 |
| LogP | 3.21 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | ZTILAOCGFRDHBH-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)c2ccc(O)cc2)cc1 |
| Storage condition | -20°C |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Phenol, 4-[[4-(1-methylethoxy)phenyl]sulfonyl]- |
| 4-(4-propan-2-yloxyphenyl)sulfonylphenol |
| 4-[(4-Isopropoxyphenyl)sulfonyl]phenol |
| 4-Isopropyloxyphenyl-4'-Hydroxyphenylsulfone |
| D8(HPS); 4-Isopropyloxyphenyl-4'-Hydroxyphenylsulfone |
| 4-{[4-(propan-2-yloxy)phenyl]sulfonyl}phenol |
| EINECS 405-520-5 |
| MFCD01861244 |
| 4-{[4-(Propan-2-yloxy)phenyl]sulfonyl}benzolol |
| 4-Hydroxy-4'-isopropoxydiphenylsulfone |