Ganoderic acid C1 structure
|
Common Name | Ganoderic acid C1 | ||
|---|---|---|---|---|
| CAS Number | 95311-97-0 | Molecular Weight | 514.65000 | |
| Density | 1.22g/cm3 | Boiling Point | 688.3ºC at 760mmHg | |
| Molecular Formula | C30H42O7 | Melting Point | 150-151 °C | |
| MSDS | N/A | Flash Point | 384.1ºC | |
Use of Ganoderic acid C1Ganoderic acid C1, a natural compound that could be isolated from G. lucidum, suppresses TNF-α production by murine macrophages (RAW 264.7 cells)[1]. |
| Name | (2R,6R)-6-[(5R,7S,10S,13R,14R,17R)-7-hydroxy-4,4,10,13,14-pentamethyl-3,11,15-trioxo-1,2,5,6,7,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxoheptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderic acid C1, a natural compound that could be isolated from G. lucidum, suppresses TNF-α production by murine macrophages (RAW 264.7 cells)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 688.3ºC at 760mmHg |
| Melting Point | 150-151 °C |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.65000 |
| Flash Point | 384.1ºC |
| Exact Mass | 514.29300 |
| PSA | 125.81000 |
| LogP | 4.33970 |
| Index of Refraction | 1.559 |
| InChIKey | YTVGSCZIHGRVAV-NJNFCIENSA-N |
| SMILES | CC(CC(=O)CC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3O)C(=O)O |
| Ganoderic acid C1 |
| (7|A,25r)-7-hydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid |