HC RED NO. 10 structure
|
Common Name | HC RED NO. 10 | ||
|---|---|---|---|---|
| CAS Number | 95576-89-9 | Molecular Weight | 261.66200 | |
| Density | 1.601±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 573.0±50.0 °C (760 mmHg) | |
| Molecular Formula | C9H12ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-Propanediol, 3-[(4-amino-2-chloro-5-nitrophenyl)amino] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.601±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 573.0±50.0 °C (760 mmHg) |
| Molecular Formula | C9H12ClN3O4 |
| Molecular Weight | 261.66200 |
| Exact Mass | 261.05200 |
| PSA | 124.33000 |
| LogP | 1.77290 |
| InChIKey | YFKNIPGAJBJZQT-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c(NCC(O)CO)cc1[N+](=O)[O-] |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HC Red 10 |
| HC Red No. 10 |
| 1-Amino-5-chloro-4-(2,3-dihydroxypropylamino)-2-nitrobenzene |