1-(4-tert-Butylbenzyl)piperazine structure
|
Common Name | 1-(4-tert-Butylbenzyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 956-61-6 | Molecular Weight | 232.36400 | |
| Density | 0.974g/cm3 | Boiling Point | 138-140°C 2mm | |
| Molecular Formula | C15H24N2 | Melting Point | 52-56 °C | |
| MSDS | Chinese USA | Flash Point | 114.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-[(4-tert-butylphenyl)methyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.974g/cm3 |
|---|---|
| Boiling Point | 138-140°C 2mm |
| Melting Point | 52-56 °C |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.36400 |
| Flash Point | 114.7ºC |
| Exact Mass | 232.19400 |
| PSA | 15.27000 |
| LogP | 2.65600 |
| Index of Refraction | 1.523 |
| InChIKey | UQLCETYSARZZSR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(CN2CCNCC2)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
|
~90%
1-(4-tert-Butyl... CAS#:956-61-6 |
| Literature: Nalluri, Siva Krishna Mohan; Ravoo, Bart Jan Angewandte Chemie - International Edition, 2010 , vol. 49, # 31 p. 5371 - 5374 |
|
~%
1-(4-tert-Butyl... CAS#:956-61-6 |
| Literature: Journal of Agricultural and Food Chemistry, , vol. 58, # 5 p. 2624 - 2629 |
|
~%
1-(4-tert-Butyl... CAS#:956-61-6 |
| Literature: GB840358 , ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-t-butylbenzyl)piperazine |
| MFCD00082594 |
| 1-p-tert-Butylbenzyl-piperazin |
| {[4-(tert-butyl)phenyl]methyl}piperazine |
| 1-(4-tert-butyl-benzyl)-piperazine |
| 1-(4-tert-Butylbenzyl)piperazine |