Cochinchinenin C structure
|
Common Name | Cochinchinenin C | ||
|---|---|---|---|---|
| CAS Number | 956103-79-0 | Molecular Weight | 542.619 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 767.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C33H34O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.5±26.4 °C | |
Use of Cochinchinenin CCochinchinenin C is a nonpolypeptide agonist of glucagon-like peptide-1 (GLP-1) receptor. Cochinchinenin C can be used for the research of diabetes[1][2]. |
| Name | Cochinchinenin C |
|---|---|
| Synonym | More Synonyms |
| Description | Cochinchinenin C is a nonpolypeptide agonist of glucagon-like peptide-1 (GLP-1) receptor. Cochinchinenin C can be used for the research of diabetes[1][2]. |
|---|---|
| Related Catalog | |
| Target |
glucagon-like peptide-1 receptor[1][2] |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 767.2±60.0 °C at 760 mmHg |
| Molecular Formula | C33H34O7 |
| Molecular Weight | 542.619 |
| Flash Point | 247.5±26.4 °C |
| Exact Mass | 542.230469 |
| PSA | 105.45000 |
| LogP | 6.26 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | SLJWKFROLINAGW-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(CCc2ccc(O)cc2OC)c2cc(CCC(=O)c3ccc(O)cc3)c(OC)cc2O)cc1 |
| 3-{4-Hydroxy-5-[3-(4-hydroxy-2-methoxyphenyl)-1-(4-methoxyphenyl)propyl]-2-methoxyphenyl}-1-(4-hydroxyphenyl)propan-1-one |
| Loureirin C |
| 3-{4-Hydroxy-5-[3-(4-hydroxy-2-methoxyphenyl)-1-(4-methoxyphenyl)propyl]-2-methoxyphenyl}-1-(4-hydroxyphenyl)-1-propanone |
| 1-Propanone, 3-[4-hydroxy-5-[3-(4-hydroxy-2-methoxyphenyl)-1-(4-methoxyphenyl)propyl]-2-methoxyphenyl]-1-(4-hydroxyphenyl)- |