SEN 1269 structure
|
Common Name | SEN 1269 | ||
|---|---|---|---|---|
| CAS Number | 956128-01-1 | Molecular Weight | 322.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SEN 1269SEN1269 is a novel potent Aβ aggregation inhibitor that binds to monomeric Aβ1-42 with Kd of 4.4 uM, protects neuronal cell lines against an Aβ1-42 insult with IC50 of 15 uM. |
| Name | 3-[[5-[3-(dimethylamino)phenoxy]pyrimidin-2-yl]amino]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18N4O2 |
|---|---|
| Molecular Weight | 322.36100 |
| Exact Mass | 322.14300 |
| PSA | 70.51000 |
| LogP | 3.85710 |
| InChIKey | MFPAAKZZUIRMKR-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc(Oc2cnc(Nc3cccc(O)c3)nc2)c1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(5-(3-(dimethylamino)phenoxy)pyrimidin-2-ylamino)phenol |
| I06-2365 |