2-NitrobenzaldehydeSemicarbazone-13C,15N2 structure
|
Common Name | 2-NitrobenzaldehydeSemicarbazone-13C,15N2 | ||
|---|---|---|---|---|
| CAS Number | 957509-32-9 | Molecular Weight | 210.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-NitrobenzaldehydeSemicarbazone-13C,15N22-Nitrobenzaldehyde semicarbazone-13C,15N2-1 is the 13C,15N2 labeled 2-Nitrobenzaldehyde semicarbazone. 2-Nitrobenzaldehyde Semicarbazone is a derivative of Semicarbazide. 2-Nitrobenzaldehyde Semicarbazone can be measured as a metabolite marker to detect the widely banned antibiotic Nitrofurazone. |
| Name | 2-NP-SCA 13C,15N2 |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Nitrobenzaldehyde semicarbazone-13C,15N2-1 is the 13C,15N2 labeled 2-Nitrobenzaldehyde semicarbazone. 2-Nitrobenzaldehyde Semicarbazone is a derivative of Semicarbazide. 2-Nitrobenzaldehyde Semicarbazone can be measured as a metabolite marker to detect the widely banned antibiotic Nitrofurazone. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C8H8N4O3 |
|---|---|
| Molecular Weight | 210.19 |
| InChIKey | OEOKLBSECDAYSM-BNWBFHBJSA-N |
| SMILES | NC(=O)NN=Cc1ccccc1[N+](=O)[O-] |
| Storage condition | -20°C |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36/37 |
| 2-NITROBENZALDEHYDE SEMICARBAZONE-13C, 15N2 |