Extracellular Death Factor trifluoroacetate salt
Modify Date: 2025-08-27 11:26:53
Extracellular Death Factor trifluoroacetate salt structure
|
Common Name | Extracellular Death Factor trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 960129-66-2 | Molecular Weight | 660.63600 | |
| Density | 1.493±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 1452.5±65.0 °C (760 mmHg) | |
| Molecular Formula | C27H36N10O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Extracellular Death Factor trifluoroacetate saltExtracellular death factor (EDF) is the only single signaling molecule involved in Escherichia coli quorum sensing, and can initiate MAZEF-mediated cell death. Extracellular death factor significantly amplifies the endoribonucleolytic activities of both MazF and ChpBK[1]. |
| Name | L-Asparagine, L-asparaginyl-L-asparaginyl-L-tryptophyl-L-asparaginyl |
|---|---|
| Synonym | More Synonyms |
| Description | Extracellular death factor (EDF) is the only single signaling molecule involved in Escherichia coli quorum sensing, and can initiate MAZEF-mediated cell death. Extracellular death factor significantly amplifies the endoribonucleolytic activities of both MazF and ChpBK[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.493±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 1452.5±65.0 °C (760 mmHg) |
| Molecular Formula | C27H36N10O10 |
| Molecular Weight | 660.63600 |
| Exact Mass | 660.26200 |
| PSA | 367.87000 |
| InChIKey | HMNOUINQUDZPAL-HILJTLORSA-N |
| SMILES | NC(=O)CC(N)C(=O)NC(CC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(N)=O)C(=O)NC(CC(N)=O)C(=O)O |
| 1: PN: WO2008084478 SEQID: 1 claimed sequence |
| Extracellular Death Factor, EDF |
| Extracellular death factor (synthetic Escherichia coli) |
| EXTRACELLULAR DEATH FACTOR |