BENZYL-2-KETO-ISOHEXANOATE structure
|
Common Name | BENZYL-2-KETO-ISOHEXANOATE | ||
|---|---|---|---|---|
| CAS Number | 96136-13-9 | Molecular Weight | 220.26400 | |
| Density | 1.07g/cm3 | Boiling Point | 322.8ºC at 760mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.5ºC | |
| Name | 3-benzyl-4-methyl-2-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 322.8ºC at 760mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 142.5ºC |
| Exact Mass | 220.11000 |
| PSA | 43.37000 |
| LogP | 2.34500 |
| Index of Refraction | 1.502 |
| InChIKey | SOVNRTNKFRLUDW-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C(=O)OCc1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~64%
BENZYL-2-KETO-I... CAS#:96136-13-9 |
| Literature: Chiesi Farmaceutici S.p.A. Patent: US6344457 B1, 2002 ; Location in patent: Page column 38 ; US 6344457 B1 |
|
~96%
BENZYL-2-KETO-I... CAS#:96136-13-9 |
| Literature: Abbott Laboratories Patent: US5268374 A1, 1993 ; |
|
~99%
BENZYL-2-KETO-I... CAS#:96136-13-9 |
| Literature: Raimondi, Wilfried; Basle, Olivier; Constantieux, Thierry; Bonne, Damien; Rodriguez, Jean Advanced Synthesis and Catalysis, 2012 , vol. 354, # 4 p. 563 - 568 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| BENZYL-2-KETO-ISOHEXANOATE |
| 4-Methyl-2-oxo-pentanoic acid,benzyl ester |
| 4-methyl-2-oxo-pentanoic phenylmethyl ester acid |
| benzyl 4-methyl-2-oxo-pentanoate |