cis-1,2-Bis(phenylsulfonyl)ethylene structure
|
Common Name | cis-1,2-Bis(phenylsulfonyl)ethylene | ||
|---|---|---|---|---|
| CAS Number | 963-15-5 | Molecular Weight | 308.37300 | |
| Density | 1.355g/cm3 | Boiling Point | 545ºC at 760mmHg | |
| Molecular Formula | C14H12O4S2 | Melting Point | 85-87ºC(lit.) | |
| MSDS | N/A | Flash Point | 363.3ºC | |
| Name | cis-1,2-Bis(phenylsulfonyl)ethylene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 545ºC at 760mmHg |
| Melting Point | 85-87ºC(lit.) |
| Molecular Formula | C14H12O4S2 |
| Molecular Weight | 308.37300 |
| Flash Point | 363.3ºC |
| Exact Mass | 308.01800 |
| PSA | 85.04000 |
| LogP | 4.56700 |
| Index of Refraction | 1.604 |
| InChIKey | YGBXMKGCEHIWMO-QXMHVHEDSA-N |
| SMILES | O=S(=O)(C=CS(=O)(=O)c1ccccc1)c1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2904100000 |
|
~97%
cis-1,2-Bis(phe... CAS#:963-15-5 |
| Literature: Cossu, Sergio; De Lucchi, Ottorino; Durr, Richard; Fabris, Fabrizio Synthetic Communications, 1996 , vol. 26, # 2 p. 211 - 216 |
|
~%
cis-1,2-Bis(phe... CAS#:963-15-5 |
| Literature: Journal of the American Chemical Society, , vol. 76, p. 5745 |
|
~%
cis-1,2-Bis(phe... CAS#:963-15-5 |
| Literature: Synthetic Communications, , vol. 26, # 2 p. 211 - 216 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| cis-1,2-bis(phenylsulfonyl)ethylene |