Benzene,1,1'-[(1E)-1,2-ethenediylbis(sulfonyl)]bis- structure
|
Common Name | Benzene,1,1'-[(1E)-1,2-ethenediylbis(sulfonyl)]bis- | ||
|---|---|---|---|---|
| CAS Number | 963-16-6 | Molecular Weight | 308.37300 | |
| Density | 1.355g/cm3 | Boiling Point | 545ºC at 760 mmHg | |
| Molecular Formula | C14H12O4S2 | Melting Point | 221-223ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 363.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | trans-1,2-Bis(phenylsulfonyl)ethylene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 545ºC at 760 mmHg |
| Melting Point | 221-223ºC(lit.) |
| Molecular Formula | C14H12O4S2 |
| Molecular Weight | 308.37300 |
| Flash Point | 363.3ºC |
| Exact Mass | 308.01800 |
| PSA | 85.04000 |
| LogP | 4.56700 |
| Index of Refraction | 1.604 |
| InChIKey | YGBXMKGCEHIWMO-VAWYXSNFSA-N |
| SMILES | O=S(=O)(C=CS(=O)(=O)c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2904100000 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Total synthesis of (+)-7-deoxypancratistatin from furan.
Org. Lett. 2(23) , 3683-6, (2000) A new total synthesis of (+)-7-deoxypancratistatin 1 has been accomplished in 19 steps (8% overall yield) from two readly available compounds, furan and trans-1,2-bis(phenylsulfonyl)ethylene. |
|
|
O. De Lucchi, L. Pasquato
Tetrahedron 44 , 6755, (1988)
|
|
|
O. De Lucchi et al.
J. Org. Chem. 49 , 596, (1984)
|
| MFCD00066528 |
| [(E)-2-(benzenesulfonyl)ethenyl]sulfonylbenzene |