2,6-Dimethoxy-9,10-anthraquinone structure
|
Common Name | 2,6-Dimethoxy-9,10-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 963-96-2 | Molecular Weight | 268.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dimethoxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O4 |
|---|---|
| Molecular Weight | 268.26400 |
| Exact Mass | 268.07400 |
| PSA | 52.60000 |
| LogP | 2.47920 |
| InChIKey | VZXGMACDZPAQOP-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(=O)c1ccc(OC)cc1C2=O |
| HS Code | 2914690090 |
|---|
|
~77%
2,6-Dimethoxy-9... CAS#:963-96-2 |
| Literature: Geiseler, Oliver; Mueller, Monika; Podlech, Joachim Tetrahedron, 2013 , vol. 69, # 18 p. 3683 - 3689 |
|
~%
2,6-Dimethoxy-9... CAS#:963-96-2 |
| Literature: Wako Pure Chemical Industries, Ltd. Patent: US5498748 A1, 1996 ; |
|
~%
2,6-Dimethoxy-9... CAS#:963-96-2 |
| Literature: Melby et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 3816 |
|
~%
2,6-Dimethoxy-9... CAS#:963-96-2 |
| Literature: Schunck; Roemer Chemische Berichte, 1876 , vol. 9, p. 381 |
|
~%
2,6-Dimethoxy-9... CAS#:963-96-2 |
| Literature: Hoechster Farbw. Patent: DE167699 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 8, p. 266 |
|
~%
2,6-Dimethoxy-9... CAS#:963-96-2 |
| Literature: Hoechster Farbwerke Patent: DE167699 ; |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,6-dimethoxybenzoquinone |
| 2,6-Dimethoxy-anthrachinon |
| 2,6-dimethoxy-9,10-anthracenedione |
| 9,10-Anthracenedione,2,6-dimethoxy |
| 2,6-dimethoxy-9,10-dihydroanthracene-9,10-dione |
| 2,6-Dimethoxy-anthraquinone |
| 2,6-dimethoxy-9,10-anthraquinone |