4,4'-Carbonyldibenzoic acid structure
|
Common Name | 4,4'-Carbonyldibenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 964-68-1 | Molecular Weight | 270.237 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 534.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C15H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1±22.4 °C | |
| Name | Benzophenone-4,4'-dicarboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 534.5±35.0 °C at 760 mmHg |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.237 |
| Flash Point | 291.1±22.4 °C |
| Exact Mass | 270.052826 |
| PSA | 91.67000 |
| LogP | 3.39 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | LFEWXDOYPCWFHR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)c2ccc(C(=O)O)cc2)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2918300090 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzoic acid, 4,4'-carbonylbis- |
| 4,4'-Carbonyldibenzoic acid |
| 4-(4-carboxybenzoyl)benzoic acid |