p-Tolyl ketone structure
|
Common Name | p-Tolyl ketone | ||
|---|---|---|---|---|
| CAS Number | 611-97-2 | Molecular Weight | 210.271 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 354.1±11.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O | Melting Point | 90-93 °C(lit.) | |
| MSDS | USA | Flash Point | 153.7±14.2 °C | |
| Name | 4,4'-Dimethylbenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.1±11.0 °C at 760 mmHg |
| Melting Point | 90-93 °C(lit.) |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.271 |
| Flash Point | 153.7±14.2 °C |
| Exact Mass | 210.104462 |
| PSA | 17.07000 |
| LogP | 4.10 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | ZWPWLKXZYNXATK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2ccc(C)cc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Complexes of Strong Bidentate Lewis Acids Derived from 2,7-Bis(1,1-dimethylethyl)fluorene-1,8-diol.
Inorg. Chem. 37(11) , 2620-2625, (1998) Treatment of 2,7-bis(1,1-dimethylethyl)fluorene-1,8-diol (3) with 2 equiv of TiCl(4) converts the two OH groups into OTiCl(3) groups and thereby yields bis(trichlorotitanium phenoxide) 7, a structural... |
| Benzophenone, 4,4'-dimethyl- |
| bis(p-tolyl)methanone |
| Methanone, bis(4-methylphenyl)- |
| 4,4'-Carbonylbis(toluene) |
| EINECS 210-287-6 |
| Di-p-tolyl ketone |
| 4,4'-Dimethylbenzophenone |
| 4,4'-Carbonylbis[toluene] |
| di(4-methylphenyl)methanone |
| Bis(4-methylphenyl)methanone |
| p-Tolyl ketone |
| MFCD00017214 |