Ethyl 2,6-dichloro-5-fluoro-pyridine-3-acetoacetate structure
|
Common Name | Ethyl 2,6-dichloro-5-fluoro-pyridine-3-acetoacetate | ||
|---|---|---|---|---|
| CAS Number | 96568-04-6 | Molecular Weight | 294.106 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 363.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H10Cl2FNO3 | Melting Point | 68-72 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 173.6±26.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Ethyl 2,6-Dichloro-5-Fluoro-Pyridine-3-Acetoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 363.4±37.0 °C at 760 mmHg |
| Melting Point | 68-72 °C(lit.) |
| Molecular Formula | C11H10Cl2FNO3 |
| Molecular Weight | 294.106 |
| Flash Point | 173.6±26.5 °C |
| Exact Mass | 293.002167 |
| PSA | 56.26000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | IEUHWNLWVMLHHC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cc(F)c(Cl)nc1Cl |
| Storage condition | -20°C Freezer |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Pyridinebutanoic acid, 2,6-dichloro-5-fluoro-β-oxo-, ethyl ester |
| MFCD00799535 |
| Ethyl 4-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-oxobutanoate |
| Ethyl 4-(2,6-dichloro-5-fluoropyridin-3-yl)-3-oxobutanoate |
| ethyl 3-(2,6-dichloro-5-fluoropyridin-3-yl)-3-oxopropanoate |