2-[(2-nitrophenoxy)methyl]-3,1-benzoxazin-4-one structure
|
Common Name | 2-[(2-nitrophenoxy)methyl]-3,1-benzoxazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 96656-56-3 | Molecular Weight | 298.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2-nitrophenoxy)methyl]-3,1-benzoxazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10N2O5 |
|---|---|
| Molecular Weight | 298.25000 |
| Exact Mass | 298.05900 |
| PSA | 98.15000 |
| LogP | 3.19840 |
| InChIKey | JLOWZLNDIJWGEW-UHFFFAOYSA-N |
| SMILES | O=c1oc(COc2ccccc2[N+](=O)[O-])nc2ccccc12 |
|
~49%
2-[(2-nitrophen... CAS#:96656-56-3 |
| Literature: Kulkarni; Abdi Journal of the Indian Chemical Society, 1984 , vol. 61, # 8 p. 721 - 722 |
|
~%
2-[(2-nitrophen... CAS#:96656-56-3 |
| Literature: Kulkarni; Abdi Journal of the Indian Chemical Society, 1984 , vol. 61, # 8 p. 721 - 722 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4H-3,1-Benzoxazin-4-one,2-[(2-nitrophenoxy)methyl] |