(2-Nitrophenoxy)acetic acid structure
|
Common Name | (2-Nitrophenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1878-87-1 | Molecular Weight | 197.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 388.3±17.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | 157-160 °C(lit.) | |
| MSDS | N/A | Flash Point | 188.7±20.9 °C | |
| Name | (2-nitrophenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 388.3±17.0 °C at 760 mmHg |
| Melting Point | 157-160 °C(lit.) |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.145 |
| Flash Point | 188.7±20.9 °C |
| Exact Mass | 197.032425 |
| PSA | 92.35000 |
| LogP | 0.94 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | TYHHDWAHJRRYCU-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccccc1[N+](=O)[O-] |
| Water Solubility | Soluble |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R22;R36/37/38;R44 |
| Safety Phrases | S22-S24/25-S37/39-S26 |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2-Nitro-phenoxy)-essigsaeure |
| 2-Nitro-phenylaetherglykolsaeure |
| o-nitrophenoxy acetic acid |
| O-(2-Nitro-phenyl)-glykolsaeure |
| 2-Nitrophenoxyacetic Acid |
| (2-Nitrophenoxy)acetic acid |
| Acetic acid, 2-(2-nitrophenoxy)- |
| F0020-1820 |
| MFCD00016993 |
| EINECS 217-527-9 |