2-nitrophenoxyacetyl chloride structure
|
Common Name | 2-nitrophenoxyacetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 20142-87-4 | Molecular Weight | 215.59100 | |
| Density | 1.434g/cm3 | Boiling Point | 329.1ºC at 760 mmHg | |
| Molecular Formula | C8H6ClNO4 | Melting Point | 43ºC | |
| MSDS | N/A | Flash Point | 152.8ºC | |
| Name | 2-(2-nitrophenoxy)acetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 329.1ºC at 760 mmHg |
| Melting Point | 43ºC |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.59100 |
| Flash Point | 152.8ºC |
| Exact Mass | 214.99900 |
| PSA | 72.12000 |
| LogP | 2.26220 |
| Vapour Pressure | 0.000181mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | AEWBGACGIKCIJH-UHFFFAOYSA-N |
| SMILES | O=C(Cl)COc1ccccc1[N+](=O)[O-] |
| Risk Phrases | R34 |
|---|---|
| Safety Phrases | S26;S36/S37/S39 |
| RIDADR | UN 3261 |
| Packaging Group | III |
| HS Code | 2918990090 |
|
~%
2-nitrophenoxya... CAS#:20142-87-4 |
| Literature: Journal of the American Chemical Society, , vol. 39, p. 2437 |
|
~%
2-nitrophenoxya... CAS#:20142-87-4 |
| Literature: Journal of the Indian Chemical Society, , vol. 73, # 11 p. 627 - 628 |
|
~%
2-nitrophenoxya... CAS#:20142-87-4 |
| Literature: Journal of the Indian Chemical Society, , vol. 69, # 1 p. 45 - 46 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Nitro-phenoxyessigsaeure-chlorid |
| AEWBGACGIKCIJH-UHFFFAOYSA |
| 2-nitrophenoxyacetyl chloride |