1,3,5-Tris(3-bromophenyl)benzene structure
|
Common Name | 1,3,5-Tris(3-bromophenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 96761-85-2 | Molecular Weight | 543.088 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 553.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C24H15Br3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.1±23.5 °C | |
| Name | 1,3,5-Tris(3-bromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 553.9±45.0 °C at 760 mmHg |
| Molecular Formula | C24H15Br3 |
| Molecular Weight | 543.088 |
| Flash Point | 277.1±23.5 °C |
| Exact Mass | 539.872375 |
| LogP | 10.38 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | JKCQADHKVQXKFF-UHFFFAOYSA-N |
| SMILES | Brc1cccc(-c2cc(-c3cccc(Br)c3)cc(-c3cccc(Br)c3)c2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2903999090 |
|
~93%
1,3,5-Tris(3-br... CAS#:96761-85-2 |
| Literature: Zhang, Shao-Liang; Xue, Zhao-Feng; Gao, Ya-Ru; Mao, Shuai; Wang, Yong-Qiang Tetrahedron Letters, 2012 , vol. 53, # 19 p. 2436 - 2439 |
|
~69%
1,3,5-Tris(3-br... CAS#:96761-85-2 |
| Literature: Woiczechowski-Pop, Adrian; Dobra, Ioana L.; Roiban, Gheorghe D.; Terec, Anamaria; Grosu, Ion Synthetic Communications, 2012 , vol. 42, # 24 p. 3579 - 3588 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3,5-tri(m-bromophenyl)benzene |
| 1,3,5-Tris-(3-bromphenyl)-benzol |
| 3,3''-Dibromo-5'-(3-bromophenyl)-1,1':3',1''-terphenyl |
| 1,3,5-tris-(3-bromophenyl)benzene |
| 1,3,5-Tris(3-bromophenyl)benzene |
| 1,3,5-tri(3-bromophenyl)benzene |