3-Methyl-4-nitrobenzonitrile structure
|
Common Name | 3-Methyl-4-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 96784-54-2 | Molecular Weight | 162.145 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 322.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H6N2O2 | Melting Point | 81-83°C | |
| MSDS | N/A | Flash Point | 148.6±24.6 °C | |
| Name | 3-Methyl-4-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 322.2±30.0 °C at 760 mmHg |
| Melting Point | 81-83°C |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.145 |
| Flash Point | 148.6±24.6 °C |
| Exact Mass | 162.042923 |
| PSA | 69.61000 |
| LogP | 1.65 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | IHVNKSXTJZNBQA-UHFFFAOYSA-N |
| SMILES | Cc1cc(C#N)ccc1[N+](=O)[O-] |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 3439 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2926909090 |
|
~%
3-Methyl-4-nitr... CAS#:96784-54-2 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 144, p. 182 |
|
~22%
3-Methyl-4-nitr... CAS#:96784-54-2 |
| Literature: ELI LILLY AND COMPANY Patent: EP655439 A2, 1995 ; |
|
~%
3-Methyl-4-nitr... CAS#:96784-54-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 40, # 18 p. 2843 - 2857 |
|
~%
3-Methyl-4-nitr... CAS#:96784-54-2 |
| Literature: Tetrahedron Letters, , vol. 26, # 1 p. 115 - 118 |
|
~%
3-Methyl-4-nitr... CAS#:96784-54-2 |
| Literature: Organic and Biomolecular Chemistry, , vol. 1, # 13 p. 2326 - 2335 |
| Precursor 5 | |
|---|---|
| DownStream 7 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00017615 |
| Benzonitrile, 3-methyl-4-nitro- |
| 3-Methyl-4-nitrobenzonitrile |