2',4'-Dimethylacetoacetanilide structure
|
Common Name | 2',4'-Dimethylacetoacetanilide | ||
|---|---|---|---|---|
| CAS Number | 97-36-9 | Molecular Weight | 205.25300 | |
| Density | 1.24 | Boiling Point | 265ºC | |
| Molecular Formula | C12H15NO2 | Melting Point | 88-91 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 171 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4-Dimethylacetoacetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24 |
|---|---|
| Boiling Point | 265ºC |
| Melting Point | 88-91 °C(lit.) |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25300 |
| Flash Point | 171 °C |
| Exact Mass | 205.11000 |
| PSA | 46.17000 |
| LogP | 2.29400 |
| Index of Refraction | 1.555 |
| InChIKey | HGVIAKXYAZRSEG-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1ccc(C)cc1C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R22 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| RTECS | AK4585000 |
| HS Code | 2924299090 |
|
~0%
2',4'-Dimethyla... CAS#:97-36-9 |
| Literature: Chikhalikar, Sandip; Bhawe, Vijay; Jachak, Madhukar; Ghagare, Maruti European Journal of Organic Chemistry, 2011 , # 30 p. 6085 - 6091 |
|
~%
2',4'-Dimethyla... CAS#:97-36-9 |
| Literature: Journal of the Indian Chemical Society, , vol. 9, p. 127,130,471,475 |
|
~%
2',4'-Dimethyla... CAS#:97-36-9 |
| Literature: US6586631 B1, ; |
|
~%
2',4'-Dimethyla... CAS#:97-36-9 |
| Literature: Journal of the American Chemical Society, , vol. 68, p. 644,645 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2',4'-Dimethylacetoacetanilide |
| EINECS 202-576-0 |
| MFCD00039836 |