4-tert-butylcalix[4]arene-tetraacetic acid tetraethyl ester structure
|
Common Name | 4-tert-butylcalix[4]arene-tetraacetic acid tetraethyl ester | ||
|---|---|---|---|---|
| CAS Number | 97600-39-0 | Molecular Weight | 993.270 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 911.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C60H80O12 | Melting Point | 155-158ºC | |
| MSDS | USA | Flash Point | 339.7±34.3 °C | |
| Name | 4-tert-butylcalix[4]arene-tetraacetic acid tetraethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 911.5±65.0 °C at 760 mmHg |
| Melting Point | 155-158ºC |
| Molecular Formula | C60H80O12 |
| Molecular Weight | 993.270 |
| Flash Point | 339.7±34.3 °C |
| Exact Mass | 992.565002 |
| PSA | 142.12000 |
| LogP | 13.96 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | HZHADWCIBZZJNV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1OCC(=O)OCC)Cc1cc(C(C)(C)C)cc(c1OCC(=O)OCC)Cc1cc(C(C)(C)C)cc(c1OCC(=O)OCC)C2 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
D. Diamond et al.
Analyst 114 , 1551, (1989)
|
|
|
Anal. Chem. 64 , 2496, (1992)
|
| Tetraethyl 2,2',2'',2'''-{[5,11,17,23-tetra-tert-butylpentacyclo[19.3.1.1.1.1]octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrayl]tetrakis(oxy)}tetraacetate |
| Acetic acid, 2,2',2'',2'''-[[5,11,17,23-tetrakis(1,1-dimethylethyl)pentacyclo[19.3.1.1.1.1]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrayl]tetra
 kis(oxy)]tetrakis-, tetraethyl ester |
| 4-tert-Butylcalix[4]arene-O,O',O'',O'''-tetraacetic acid tetraethyl ester |
| MFCD00145373 |
| acetic acid, 2,2',2'',2'''-[[5,11,17,23-tetrakis(1,1-dimethylethyl)pentacyclo[19.3.1.1.1.1]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrayl]tetrakis(oxy)]tetrakis-, tetraethyl ester |
| Tetraethyl 2,2',2'',2'''-{[5,11,17,23-tetrakis(2-methyl-2-propanyl)pentacyclo[19.3.1.1.1.1]octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-dodecaene-25,26,27,28-tetrayl]tetra
 kis(oxy)}tetraacetate |
| Sodium ionophore X |