Ganoderic acid D2 structure
|
Common Name | Ganoderic acid D2 | ||
|---|---|---|---|---|
| CAS Number | 97653-94-6 | Molecular Weight | 514.650 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 688.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H42O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 384.1±28.0 °C | |
Use of Ganoderic acid D2Ganoderic acid D2 (compound 27) is a triterpenoid isolated from Ganoderma lucidum. Ganoderic acid D2 has anticancer, anti-inflammatory and antioxidative activity[1]. |
| Name | (7β)-7-Hydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderic acid D2 (compound 27) is a triterpenoid isolated from Ganoderma lucidum. Ganoderic acid D2 has anticancer, anti-inflammatory and antioxidative activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 688.3±55.0 °C at 760 mmHg |
| Molecular Formula | C30H42O8 |
| Molecular Weight | 514.650 |
| Flash Point | 384.1±28.0 °C |
| Exact Mass | 514.293030 |
| LogP | 2.43 |
| Vapour Pressure | 0.0±4.9 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | LCIUOVOXWPIXOR-OHISEBISSA-N |
| SMILES | CC(CC(=O)CC(C)C1CC(=O)C2(C)C3=C(C(=O)C(O)C12C)C1(C)CCC(=O)C(C)(C)C1CC3O)C(=O)O |
| Lanost-8-en-26-oic acid, 7-hydroxy-3,11,15,23-tetraoxo-, (7β)- |
| (7β)-7-Hydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid |
| Ganoderic acid D2 |