Ganoderic acid ε
Modify Date: 2025-11-04 17:23:54
Ganoderic acid ε structure
|
Common Name | Ganoderic acid ε | ||
|---|---|---|---|---|
| CAS Number | 294674-05-8 | Molecular Weight | 516.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H44O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ganoderic acid εGanoderic acid ε is a natural terpenoid isolated from the Fungus Ganoderma lucidum. Ganoderic acid ε exhibits an ED50 of 12.2 μg/mL in Meth-A tumor cells[1] |
| Name | Ganoderic acid ε |
|---|
| Description | Ganoderic acid ε is a natural terpenoid isolated from the Fungus Ganoderma lucidum. Ganoderic acid ε exhibits an ED50 of 12.2 μg/mL in Meth-A tumor cells[1] |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C30H44O7 |
|---|---|
| Molecular Weight | 516.67 |
| InChIKey | MIWGXXQCEDNROQ-UZOYOLKESA-N |
| SMILES | CC(=CC(O)CC(C)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O |