2,6,7-trihydroxy-9-(4-nitrophenyl)xanthen-3-one structure
|
Common Name | 2,6,7-trihydroxy-9-(4-nitrophenyl)xanthen-3-one | ||
|---|---|---|---|---|
| CAS Number | 981-81-7 | Molecular Weight | 365.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H11NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6,7-trihydroxy-9-(4-nitrophenyl)xanthen-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H11NO7 |
|---|---|
| Molecular Weight | 365.29300 |
| Exact Mass | 365.05400 |
| PSA | 136.72000 |
| LogP | 4.11300 |
| InChIKey | BBMNKGZWQXSXET-UHFFFAOYSA-N |
| SMILES | O=c1cc2oc3cc(O)c(O)cc3c(-c3ccc([N+](=O)[O-])cc3)c-2cc1O |
|
~%
2,6,7-trihydrox... CAS#:981-81-7 |
| Literature: Sano Bulletin of the Chemical Society of Japan, 1958 , vol. 31, p. 974,978, 979 Bulletin of the Chemical Society of Japan, 1959 , vol. 32, p. 299,300 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3H-Xanthen-3-one,2,6,7-trihydroxy-9-(4-nitrophenyl) |
| 9-p-nitrophenyl-2,3,7-trihydroxy-6-fluorones |
| 2,3,7-Trihydroxy-9-(-4-nitrophenyl)-6-fluoron |
| 2,6,7-trihydroxy-9-(4-nitro-phenyl)-xanthen-3-one |
| 2,6,7-Trihydroxy-9-(4-nitro-phenyl)-xanthen-3-on |
| 2,3,7-Trihydroxy-9-<4-nitro-phenyl>-fluoron-(6) |